C43H38N6O7 — CID 134481353
2-(2,6-dioxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione (PubChem CID 134481353) has the molecular formula C43H38N6O7 and a molecular weight of 750.81 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481353 |
| Molecular Formula | C43H38N6O7 |
| Molecular Weight | 750.81 g/mol |
| Exact Mass | 750.28 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCCCCc4ccc(OC5CC(Oc6ccc(-c7ccc8c(c7)[nH]c7ccncc78)cn6)C5)cn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C43H38N6O7/c50-39-13-12-38(41(51)48-39)49-42(52)33-11-9-28(21-34(33)43(49)53)54-17-3-1-2-4-27-7-8-29(23-45-27)55-30-19-31(20-30)56-40-14-6-26(22-46-40)25-5-10-32-35-24-44-16-15-36(35)47-37(32)18-25/h5-11,14-16,18,21-24,30-31,38,47H,1-4,12-13,17,19-20H2,(H,48,50,51) |
| InChIKey | FQZSDYFGUSEVQL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 165.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.81 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|