C43H36N6O7 — CID 165371600
3-[3-oxo-5-[2-[3-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]prop-2-ynoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165371600) has the molecular formula C43H36N6O7 and a molecular weight of 748.80 g/mol. Its IUPAC name is 3-[3-oxo-5-[2-[3-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]prop-2-ynoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-5-[2-[3-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]prop-2-ynoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165371600 |
| Molecular Formula | C43H36N6O7 |
| Molecular Weight | 748.80 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | 3-[3-oxo-5-[2-[3-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]prop-2-ynoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(OCCOCC#Cc4ccc(OC5CC(Oc6ccc(-c7ccc8c(c7)[nH]c7ccncc78)cn6)C5)cn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C43H36N6O7/c50-40-11-10-39(42(51)48-40)49-25-28-3-7-30(21-35(28)43(49)52)54-17-16-53-15-1-2-29-6-8-31(23-45-29)55-32-19-33(20-32)56-41-12-5-27(22-46-41)26-4-9-34-36-24-44-14-13-37(36)47-38(34)18-26/h3-9,12-14,18,21-24,32-33,39,47H,10-11,15-17,19-20,25H2,(H,48,50,51) |
| InChIKey | KIIKSZULVIJKDY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 157.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.80 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|