C44H44N6O8 — CID 134481500
2-(2,6-dioxopiperidin-3-yl)-5-[6-oxo-6-[4-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]hexoxy]isoindole-1,3-dione (PubChem CID 134481500) has the molecular formula C44H44N6O8 and a molecular weight of 784.87 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[6-oxo-6-[4-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]hexoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[6-oxo-6-[4-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]hexoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481500 |
| Molecular Formula | C44H44N6O8 |
| Molecular Weight | 784.87 g/mol |
| Exact Mass | 784.32 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[6-oxo-6-[4-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]hexoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCCCCC(=O)N4CCC(OC5CC(Oc6ccc(-c7ccc8c(c7)[nH]c7ccncc78)cn6)C5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C44H44N6O8/c51-39-11-10-38(42(53)48-39)50-43(54)33-9-7-29(23-34(33)44(50)55)56-19-3-1-2-4-41(52)49-17-14-28(15-18-49)57-30-21-31(22-30)58-40-12-6-27(24-46-40)26-5-8-32-35-25-45-16-13-36(35)47-37(32)20-26/h5-9,12-13,16,20,23-25,28,30-31,38,47H,1-4,10-11,14-15,17-19,21-22H2,(H,48,51,53) |
| InChIKey | AJHUSKXLPZWOBV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 173.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.87 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|