C44H46N6O7 — CID 134481619
2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]pentoxy]isoindole-1,3-dione (PubChem CID 134481619) has the molecular formula C44H46N6O7 and a molecular weight of 770.89 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]pentoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]pentoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481619 |
| Molecular Formula | C44H46N6O7 |
| Molecular Weight | 770.89 g/mol |
| Exact Mass | 770.34 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypiperidin-1-yl]pentoxy]isoindole-1,3-dione |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OC4CC(OC5CCN(CCCCCOc6ccc7c(c6)C(=O)N(C6CCC(=O)NC6=O)C7=O)CC5)C4)nc3)cc21 |
| InChI | InChI=1S/C44H46N6O7/c1-48-37-13-16-45-26-36(37)33-8-5-27(21-39(33)48)28-6-12-41(46-25-28)57-32-22-31(23-32)56-29-14-18-49(19-15-29)17-3-2-4-20-55-30-7-9-34-35(24-30)44(54)50(43(34)53)38-10-11-40(51)47-42(38)52/h5-9,12-13,16,21,24-26,29,31-32,38H,2-4,10-11,14-15,17-20,22-23H2,1H3,(H,47,51,52) |
| InChIKey | IRIKKSWWAPPVFG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.89 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|