C39H41F2N5O7 — CID 165371568
5-[5-[4-[3-[5-(difluoromethyl)pyrido[4,3-b]indol-7-yl]oxycyclobutyl]oxypiperidin-1-yl]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 165371568) has the molecular formula C39H41F2N5O7 and a molecular weight of 729.78 g/mol. Its IUPAC name is 5-[5-[4-[3-[5-(difluoromethyl)pyrido[4,3-b]indol-7-yl]oxycyclobutyl]oxypiperidin-1-yl]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[5-[4-[3-[5-(difluoromethyl)pyrido[4,3-b]indol-7-yl]oxycyclobutyl]oxypiperidin-1-yl]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 165371568 |
| Molecular Formula | C39H41F2N5O7 |
| Molecular Weight | 729.78 g/mol |
| Exact Mass | 729.30 |
| IUPAC Name | 5-[5-[4-[3-[5-(difluoromethyl)pyrido[4,3-b]indol-7-yl]oxycyclobutyl]oxypiperidin-1-yl]pentoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCCCCN4CCC(OC5CC(Oc6ccc7c8cnccc8n(C(F)F)c7c6)C5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H41F2N5O7/c40-39(41)45-32-10-13-42-22-31(32)28-6-5-25(21-34(28)45)53-27-18-26(19-27)52-23-11-15-44(16-12-23)14-2-1-3-17-51-24-4-7-29-30(20-24)38(50)46(37(29)49)33-8-9-35(47)43-36(33)48/h4-7,10,13,20-23,26-27,33,39H,1-3,8-9,11-12,14-19H2,(H,43,47,48) |
| InChIKey | CTIBGDNHZPSWBF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.78 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|