C44H40N6O6 — CID 167560544
2-(6-methylidene-2-oxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione (PubChem CID 167560544) has the molecular formula C44H40N6O6 and a molecular weight of 748.84 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167560544 |
| Molecular Formula | C44H40N6O6 |
| Molecular Weight | 748.84 g/mol |
| Exact Mass | 748.30 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[5-[5-[3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxy-2-pyridinyl]pentoxy]isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3ccc(OCCCCCc4ccc(OC5CC(Oc6ccc(-c7ccc8c(c7)[nH]c7ccncc78)cn6)C5)cn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C44H40N6O6/c1-26-6-14-40(42(51)48-26)50-43(52)35-13-11-30(22-36(35)44(50)53)54-18-4-2-3-5-29-9-10-31(24-46-29)55-32-20-33(21-32)56-41-15-8-28(23-47-41)27-7-12-34-37-25-45-17-16-38(37)49-39(34)19-27/h7-13,15-17,19,22-25,32-33,40,49H,1-6,14,18,20-21H2,(H,48,51) |
| InChIKey | GPTJDUQWKCLJRR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.84 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|