C22H21BrN6O4 — CID 172611329
5-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione (PubChem CID 172611329) has the molecular formula C22H21BrN6O4 and a molecular weight of 513.35 g/mol. Its IUPAC name is 5-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611329 |
| Molecular Formula | C22H21BrN6O4 |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 5-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3ccc(CN4CCN(c5ccncc5Br)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H21BrN6O4/c23-17-12-24-5-3-18(17)27-9-7-26(8-10-27)13-14-1-2-15-16(11-14)21(32)29(20(15)31)28-6-4-19(30)25-22(28)33/h1-3,5,11-12H,4,6-10,13H2,(H,25,30,33) |
| InChIKey | CDPLPLRQCADGHE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|