C21H20ClN7O4 — CID 172611170
5-[[4-(6-chloropyridazin-3-yl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione (PubChem CID 172611170) has the molecular formula C21H20ClN7O4 and a molecular weight of 469.89 g/mol. Its IUPAC name is 5-[[4-(6-chloropyridazin-3-yl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-(6-chloropyridazin-3-yl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611170 |
| Molecular Formula | C21H20ClN7O4 |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 5-[[4-(6-chloropyridazin-3-yl)piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3ccc(CN4CCN(c5ccc(Cl)nn5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H20ClN7O4/c22-16-3-4-17(25-24-16)27-9-7-26(8-10-27)12-13-1-2-14-15(11-13)20(32)29(19(14)31)28-6-5-18(30)23-21(28)33/h1-4,11H,5-10,12H2,(H,23,30,33) |
| InChIKey | HADWEWJTEPCGIK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|