C31H31N5O4 — CID 172611413
5-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione (PubChem CID 172611413) has the molecular formula C31H31N5O4 and a molecular weight of 537.62 g/mol. Its IUPAC name is 5-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione.
| Compound Name | 5-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611413 |
| Molecular Formula | C31H31N5O4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 5-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
| SMILES | C[C@@H]1CN(C(c2ccccc2)c2ccccc2)CCN1Cc1ccc2c(c1)C(=O)N(N1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C31H31N5O4/c1-21-19-34(28(23-8-4-2-5-9-23)24-10-6-3-7-11-24)17-16-33(21)20-22-12-13-25-26(18-22)30(39)36(29(25)38)35-15-14-27(37)32-31(35)40/h2-13,18,21,28H,14-17,19-20H2,1H3,(H,32,37,40)/t21-/m1/s1 |
| InChIKey | FGNSXUZPNBVYRW-OAQYLSRUSA-N |
| XLogP | 3.44 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|