C32H36N4O2S — CID 176674576
3-[4-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674576) has the molecular formula C32H36N4O2S and a molecular weight of 540.73 g/mol. Its IUPAC name is 3-[4-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674576 |
| Molecular Formula | C32H36N4O2S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 3-[4-[[(2R)-4-benzhydryl-2-methylpiperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[C@@H]1CN(C(c2ccccc2)c2ccccc2)CCN1Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2S |
| InChI | InChI=1S/C32H36N4O2S/c1-22-19-35(30(23-9-4-2-5-10-23)24-11-6-3-7-12-24)18-17-34(22)20-25-13-8-14-26-27(25)21-36(32(26)39)28-15-16-29(37)33-31(28)38/h2-14,22,28,30,32,39H,15-21H2,1H3,(H,33,37,38)/t22-,28?,32?/m1/s1 |
| InChIKey | RNTDFFZZVAMZNZ-UQZYDCJSSA-N |
| XLogP | 4.53 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|