C33H38N4O2S — CID 176674478
3-[6-[(4-benzhydryl-2,6-dimethylpiperazin-1-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674478) has the molecular formula C33H38N4O2S and a molecular weight of 554.76 g/mol. Its IUPAC name is 3-[6-[(4-benzhydryl-2,6-dimethylpiperazin-1-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(4-benzhydryl-2,6-dimethylpiperazin-1-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674478 |
| Molecular Formula | C33H38N4O2S |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 3-[6-[(4-benzhydryl-2,6-dimethylpiperazin-1-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1CN(C(c2ccccc2)c2ccccc2)CC(C)N1Cc1ccc2c(c1)C(S)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C33H38N4O2S/c1-22-18-35(31(25-9-5-3-6-10-25)26-11-7-4-8-12-26)19-23(2)36(22)20-24-13-14-27-21-37(33(40)28(27)17-24)29-15-16-30(38)34-32(29)39/h3-14,17,22-23,29,31,33,40H,15-16,18-21H2,1-2H3,(H,34,38,39) |
| InChIKey | HKMHMXJAIQVXPJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|