C24H27FN4O2S — CID 176674445
3-[6-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674445) has the molecular formula C24H27FN4O2S and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-[6-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674445 |
| Molecular Formula | C24H27FN4O2S |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 3-[6-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCN(c5ccc(F)cc5)CC4)cc3C2S)C(=O)N1 |
| InChI | InChI=1S/C24H27FN4O2S/c25-18-3-5-19(6-4-18)28-11-9-27(10-12-28)14-16-1-2-17-15-29(24(32)20(17)13-16)21-7-8-22(30)26-23(21)31/h1-6,13,21,24,32H,7-12,14-15H2,(H,26,30,31) |
| InChIKey | SNJOAPLCDUWKOR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|