C25H30N4O3S — CID 176674552
3-[6-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674552) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is 3-[6-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674552 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 3-[6-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccccc1N1CCN(Cc2ccc3c(c2)C(S)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C25H30N4O3S/c1-32-22-5-3-2-4-20(22)28-12-10-27(11-13-28)15-17-6-7-18-16-29(25(33)19(18)14-17)21-8-9-23(30)26-24(21)31/h2-7,14,21,25,33H,8-13,15-16H2,1H3,(H,26,30,31) |
| InChIKey | KBQLGESJFXBWNP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|