C26H28F3N3O2S — CID 176674540
3-[1-sulfanyl-6-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674540) has the molecular formula C26H28F3N3O2S and a molecular weight of 503.59 g/mol. Its IUPAC name is 3-[1-sulfanyl-6-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-sulfanyl-6-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674540 |
| Molecular Formula | C26H28F3N3O2S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 3-[1-sulfanyl-6-[[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCC(c5cccc(C(F)(F)F)c5)CC4)cc3C2S)C(=O)N1 |
| InChI | InChI=1S/C26H28F3N3O2S/c27-26(28,29)20-3-1-2-18(13-20)17-8-10-31(11-9-17)14-16-4-5-19-15-32(25(35)21(19)12-16)22-6-7-23(33)30-24(22)34/h1-5,12-13,17,22,25,35H,6-11,14-15H2,(H,30,33,34) |
| InChIKey | GMOMGSPDPSOIIX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|