C20H21F3N6O2S — CID 176674559
3-[1-sulfanyl-5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674559) has the molecular formula C20H21F3N6O2S and a molecular weight of 466.49 g/mol. Its IUPAC name is 3-[1-sulfanyl-5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-sulfanyl-5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674559 |
| Molecular Formula | C20H21F3N6O2S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-[1-sulfanyl-5-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCn5c(nnc5C(F)(F)F)C4)ccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C20H21F3N6O2S/c21-20(22,23)19-26-25-15-10-27(5-6-28(15)19)8-11-1-2-13-12(7-11)9-29(18(13)32)14-3-4-16(30)24-17(14)31/h1-2,7,14,18,32H,3-6,8-10H2,(H,24,30,31) |
| InChIKey | ARHHGEQMHGRUSP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|