C24H26N6O2S2 — CID 176674688
3-[1-sulfanyl-5-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674688) has the molecular formula C24H26N6O2S2 and a molecular weight of 494.65 g/mol. Its IUPAC name is 3-[1-sulfanyl-5-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-sulfanyl-5-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674688 |
| Molecular Formula | C24H26N6O2S2 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 3-[1-sulfanyl-5-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCN(c5ncnc6sccc56)CC4)ccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C24H26N6O2S2/c31-20-4-3-19(22(32)27-20)30-13-16-11-15(1-2-17(16)24(30)33)12-28-6-8-29(9-7-28)21-18-5-10-34-23(18)26-14-25-21/h1-2,5,10-11,14,19,24,33H,3-4,6-9,12-13H2,(H,27,31,32) |
| InChIKey | DHKCSZODMHOQMZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|