C30H30N6O2S2 — CID 176674613
3-[6-[[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674613) has the molecular formula C30H30N6O2S2 and a molecular weight of 570.74 g/mol. Its IUPAC name is 3-[6-[[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674613 |
| Molecular Formula | C30H30N6O2S2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | 3-[6-[[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCN(c5ncnc6scc(-c7ccccc7)c56)CC4)cc3C2S)C(=O)N1 |
| InChI | InChI=1S/C30H30N6O2S2/c37-25-9-8-24(28(38)33-25)36-16-21-7-6-19(14-22(21)30(36)39)15-34-10-12-35(13-11-34)27-26-23(20-4-2-1-3-5-20)17-40-29(26)32-18-31-27/h1-7,14,17-18,24,30,39H,8-13,15-16H2,(H,33,37,38) |
| InChIKey | QRFDZZUAGVNOCU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|