C25H27F3N4O2S — CID 176674775
3-[1-sulfanyl-6-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674775) has the molecular formula C25H27F3N4O2S and a molecular weight of 504.58 g/mol. Its IUPAC name is 3-[1-sulfanyl-6-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-sulfanyl-6-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674775 |
| Molecular Formula | C25H27F3N4O2S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 3-[1-sulfanyl-6-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCN(c5ccc(C(F)(F)F)cc5)CC4)cc3C2S)C(=O)N1 |
| InChI | InChI=1S/C25H27F3N4O2S/c26-25(27,28)18-3-5-19(6-4-18)31-11-9-30(10-12-31)14-16-1-2-17-15-32(24(35)20(17)13-16)21-7-8-22(33)29-23(21)34/h1-6,13,21,24,35H,7-12,14-15H2,(H,29,33,34) |
| InChIKey | LKTITMLMSBRPRK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|