C26H25FN4O2S — CID 176674680
3-[5-[[3-(7-fluoroquinolin-4-yl)azetidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674680) has the molecular formula C26H25FN4O2S and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-[5-[[3-(7-fluoroquinolin-4-yl)azetidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[3-(7-fluoroquinolin-4-yl)azetidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674680 |
| Molecular Formula | C26H25FN4O2S |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-[5-[[3-(7-fluoroquinolin-4-yl)azetidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CC(c5ccnc6cc(F)ccc56)C4)ccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C26H25FN4O2S/c27-18-2-4-21-19(7-8-28-22(21)10-18)17-12-30(13-17)11-15-1-3-20-16(9-15)14-31(26(20)34)23-5-6-24(32)29-25(23)33/h1-4,7-10,17,23,26,34H,5-6,11-14H2,(H,29,32,33) |
| InChIKey | YKGLCLWMHSBZKC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|