C25H25ClFN3O2S — CID 176674370
3-[5-[[4-(2-chloro-3-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674370) has the molecular formula C25H25ClFN3O2S and a molecular weight of 486.01 g/mol. Its IUPAC name is 3-[5-[[4-(2-chloro-3-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[4-(2-chloro-3-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674370 |
| Molecular Formula | C25H25ClFN3O2S |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[5-[[4-(2-chloro-3-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CC=C(c5cccc(F)c5Cl)CC4)ccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C25H25ClFN3O2S/c26-23-18(2-1-3-20(23)27)16-8-10-29(11-9-16)13-15-4-5-19-17(12-15)14-30(25(19)33)21-6-7-22(31)28-24(21)32/h1-5,8,12,21,25,33H,6-7,9-11,13-14H2,(H,28,31,32) |
| InChIKey | HHBQXOGTJQRMHC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|