C26H28Cl2N4O2S — CID 176674642
3-[5-[[3-(2,3-dichlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674642) has the molecular formula C26H28Cl2N4O2S and a molecular weight of 531.51 g/mol. Its IUPAC name is 3-[5-[[3-(2,3-dichlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[3-(2,3-dichlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674642 |
| Molecular Formula | C26H28Cl2N4O2S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 3-[5-[[3-(2,3-dichlorophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4C5CCC4CN(c4cccc(Cl)c4Cl)C5)ccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C26H28Cl2N4O2S/c27-20-2-1-3-21(24(20)28)30-13-17-5-6-18(14-30)31(17)11-15-4-7-19-16(10-15)12-32(26(19)35)22-8-9-23(33)29-25(22)34/h1-4,7,10,17-18,22,26,35H,5-6,8-9,11-14H2,(H,29,33,34) |
| InChIKey | PFBZGMPXQBNPBM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|