C33H36N4O2S — CID 176674735
3-[5-[(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674735) has the molecular formula C33H36N4O2S and a molecular weight of 552.74 g/mol. Its IUPAC name is 3-[5-[(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674735 |
| Molecular Formula | C33H36N4O2S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 3-[5-[(3-benzhydryl-3,8-diazabicyclo[3.2.1]octan-8-yl)methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4C5CCC4CN(C(c4ccccc4)c4ccccc4)C5)ccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C33H36N4O2S/c38-30-16-15-29(32(39)34-30)37-19-25-17-22(11-14-28(25)33(37)40)18-36-26-12-13-27(36)21-35(20-26)31(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-11,14,17,26-27,29,31,33,40H,12-13,15-16,18-21H2,(H,34,38,39) |
| InChIKey | RFVMERURRPCILU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|