C25H26Cl2N4O2S — CID 176674727
3-[5-[[(1S,4S)-5-(2,3-dichlorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674727) has the molecular formula C25H26Cl2N4O2S and a molecular weight of 517.48 g/mol. Its IUPAC name is 3-[5-[[(1S,4S)-5-(2,3-dichlorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[(1S,4S)-5-(2,3-dichlorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674727 |
| Molecular Formula | C25H26Cl2N4O2S |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 3-[5-[[(1S,4S)-5-(2,3-dichlorophenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4C[C@@H]5C[C@H]4CN5c4cccc(Cl)c4Cl)ccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C25H26Cl2N4O2S/c26-19-2-1-3-20(23(19)27)30-13-16-9-17(30)12-29(16)10-14-4-5-18-15(8-14)11-31(25(18)34)21-6-7-22(32)28-24(21)33/h1-5,8,16-17,21,25,34H,6-7,9-13H2,(H,28,32,33)/t16-,17-,21?,25?/m0/s1 |
| InChIKey | JSYLHDIYMBBLDI-LAWFAZMCSA-N |
| XLogP | 4.01 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|