C22H24Cl2N6O2S — CID 176674509
3-[4-[[4-(3,6-dichloropyridazin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674509) has the molecular formula C22H24Cl2N6O2S and a molecular weight of 507.45 g/mol. Its IUPAC name is 3-[4-[[4-(3,6-dichloropyridazin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-(3,6-dichloropyridazin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674509 |
| Molecular Formula | C22H24Cl2N6O2S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 3-[4-[[4-(3,6-dichloropyridazin-4-yl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCN(c5cc(Cl)nnc5Cl)CC4)cccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C22H24Cl2N6O2S/c23-18-10-17(20(24)27-26-18)29-8-6-28(7-9-29)11-13-2-1-3-14-15(13)12-30(22(14)33)16-4-5-19(31)25-21(16)32/h1-3,10,16,22,33H,4-9,11-12H2,(H,25,31,32) |
| InChIKey | XAPDOFZUXDRHAY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|