C23H26BrN5O2S — CID 176674523
3-[4-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674523) has the molecular formula C23H26BrN5O2S and a molecular weight of 516.47 g/mol. Its IUPAC name is 3-[4-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674523 |
| Molecular Formula | C23H26BrN5O2S |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 3-[4-[[4-(3-bromo-4-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCN(c5ccncc5Br)CC4)cccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C23H26BrN5O2S/c24-18-12-25-7-6-19(18)28-10-8-27(9-11-28)13-15-2-1-3-16-17(15)14-29(23(16)32)20-4-5-21(30)26-22(20)31/h1-3,6-7,12,20,23,32H,4-5,8-11,13-14H2,(H,26,30,31) |
| InChIKey | TUEPNQHMUDFUIQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|