C23H25Cl2N5O2S — CID 176674782
3-[4-[[4-(4,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674782) has the molecular formula C23H25Cl2N5O2S and a molecular weight of 506.46 g/mol. Its IUPAC name is 3-[4-[[4-(4,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-(4,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674782 |
| Molecular Formula | C23H25Cl2N5O2S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 3-[4-[[4-(4,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCN(c5cc(Cl)c(Cl)cn5)CC4)cccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C23H25Cl2N5O2S/c24-17-10-20(26-11-18(17)25)29-8-6-28(7-9-29)12-14-2-1-3-15-16(14)13-30(23(15)33)19-4-5-21(31)27-22(19)32/h1-3,10-11,19,23,33H,4-9,12-13H2,(H,27,31,32) |
| InChIKey | SHUYCKDMFNWCDZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|