C30H33N5O2S — CID 176674475
3-[4-[[4-[(2-phenyl-3-pyridinyl)methyl]piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674475) has the molecular formula C30H33N5O2S and a molecular weight of 527.69 g/mol. Its IUPAC name is 3-[4-[[4-[(2-phenyl-3-pyridinyl)methyl]piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-[(2-phenyl-3-pyridinyl)methyl]piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674475 |
| Molecular Formula | C30H33N5O2S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 3-[4-[[4-[(2-phenyl-3-pyridinyl)methyl]piperazin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCN(Cc5cccnc5-c5ccccc5)CC4)cccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C30H33N5O2S/c36-27-12-11-26(29(37)32-27)35-20-25-22(8-4-10-24(25)30(35)38)18-33-14-16-34(17-15-33)19-23-9-5-13-31-28(23)21-6-2-1-3-7-21/h1-10,13,26,30,38H,11-12,14-20H2,(H,32,36,37) |
| InChIKey | GTFZZLGLWISAKI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|