C31H31N5O2S2 — CID 176674862
3-[4-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 176674862) has the molecular formula C31H31N5O2S2 and a molecular weight of 569.76 g/mol. Its IUPAC name is 3-[4-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176674862 |
| Molecular Formula | C31H31N5O2S2 |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 3-[4-[[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]-1-sulfanyl-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(CN4CCC(c5ncnc6sc(-c7ccccc7)cc56)CC4)cccc3C2S)C(=O)N1 |
| InChI | InChI=1S/C31H31N5O2S2/c37-27-10-9-25(29(38)34-27)36-17-24-21(7-4-8-22(24)31(36)39)16-35-13-11-20(12-14-35)28-23-15-26(19-5-2-1-3-6-19)40-30(23)33-18-32-28/h1-8,15,18,20,25,31,39H,9-14,16-17H2,(H,34,37,38) |
| InChIKey | GHPPNJSCGQCUEC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|