C29H29NO2S — CID 58026828
1-[6-(2-methoxyphenyl)-2,2,4-trimethyl-5-(phenylsulfanylmethyl)quinolin-1-yl]prop-2-en-1-one (PubChem CID 58026828) has the molecular formula C29H29NO2S and a molecular weight of 455.62 g/mol. Its IUPAC name is 1-[6-(2-methoxyphenyl)-2,2,4-trimethyl-5-(phenylsulfanylmethyl)quinolin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[6-(2-methoxyphenyl)-2,2,4-trimethyl-5-(phenylsulfanylmethyl)quinolin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 58026828 |
| Molecular Formula | C29H29NO2S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-[6-(2-methoxyphenyl)-2,2,4-trimethyl-5-(phenylsulfanylmethyl)quinolin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1c2ccc(-c3ccccc3OC)c(CSc3ccccc3)c2C(C)=CC1(C)C |
| InChI | InChI=1S/C29H29NO2S/c1-6-27(31)30-25-17-16-22(23-14-10-11-15-26(23)32-5)24(19-33-21-12-8-7-9-13-21)28(25)20(2)18-29(30,3)4/h6-18H,1,19H2,2-5H3 |
| InChIKey | IVSFCKIOGIYFLF-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|