C15H15NO3S2 — CID 57303304
5-[4-(3,4-dimethoxyphenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 57303304) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-[4-(3,4-dimethoxyphenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[4-(3,4-dimethoxyphenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57303304 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-[4-(3,4-dimethoxyphenyl)but-3-en-2-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=CC(C)=C2SC(=S)NC2=O)cc1OC |
| InChI | InChI=1S/C15H15NO3S2/c1-9(13-14(17)16-15(20)21-13)4-5-10-6-7-11(18-2)12(8-10)19-3/h4-8H,1-3H3,(H,16,17,20) |
| InChIKey | IINXMZVHZJSIPW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|