C18H19NO6S2 — CID 173335793
methyl 2-methoxy-2-[2-methoxy-4-[3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenoxy]acetate (PubChem CID 173335793) has the molecular formula C18H19NO6S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is methyl 2-methoxy-2-[2-methoxy-4-[3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenoxy]acetate.
| Compound Name | methyl 2-methoxy-2-[2-methoxy-4-[3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 173335793 |
| Molecular Formula | C18H19NO6S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | methyl 2-methoxy-2-[2-methoxy-4-[3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenoxy]acetate |
| SMILES | COC(=O)C(OC)Oc1ccc(C=CC(C)=C2SC(=S)NC2=O)cc1OC |
| InChI | InChI=1S/C18H19NO6S2/c1-10(14-15(20)19-18(26)27-14)5-6-11-7-8-12(13(9-11)22-2)25-17(24-4)16(21)23-3/h5-9,17H,1-4H3,(H,19,20,26) |
| InChIKey | IFDWFFJHYDQUAX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|