C19H21NO5S2 — CID 57116075
[2-methoxy-4-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenyl] 2-hydroxybutanoate (PubChem CID 57116075) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is [2-methoxy-4-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenyl] 2-hydroxybutanoate.
| Compound Name | [2-methoxy-4-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenyl] 2-hydroxybutanoate |
|---|---|
| PubChem CID | 57116075 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [2-methoxy-4-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)but-1-enyl]phenyl] 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)Oc1ccc(C=CC(C)=C2SC(=S)N(C)C2=O)cc1OC |
| InChI | InChI=1S/C19H21NO5S2/c1-5-13(21)18(23)25-14-9-8-12(10-15(14)24-4)7-6-11(2)16-17(22)20(3)19(26)27-16/h6-10,13,21H,5H2,1-4H3 |
| InChIKey | PGSFTXHVJDHCLE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|