C26H28N2O5 — CID 4078169
(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 4078169) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-4-oxopiperidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | (2,2,6,6-tetramethyl-4-oxopiperidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 4078169 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (2,2,6,6-tetramethyl-4-oxopiperidin-1-yl) 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1OC(=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H28N2O5/c1-25(2)15-18(29)16-26(3,4)28(25)33-24(32)21(14-17-10-6-5-7-11-17)27-22(30)19-12-8-9-13-20(19)23(27)31/h5-13,21H,14-16H2,1-4H3 |
| InChIKey | ZRSPWXXFQAZAKY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|