C22H21NO3S3 — CID 3119248
(3-ethoxyphenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone (PubChem CID 3119248) has the molecular formula C22H21NO3S3 and a molecular weight of 443.62 g/mol. Its IUPAC name is (3-ethoxyphenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone.
| Compound Name | (3-ethoxyphenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone |
|---|---|
| PubChem CID | 3119248 |
| Molecular Formula | C22H21NO3S3 |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (3-ethoxyphenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone |
| SMILES | CCOc1cccc(C(=O)N2c3c(OC)cccc3-c3c(ssc3=S)C2(C)C)c1 |
| InChI | InChI=1S/C22H21NO3S3/c1-5-26-14-9-6-8-13(12-14)20(24)23-18-15(10-7-11-16(18)25-4)17-19(22(23,2)3)28-29-21(17)27/h6-12H,5H2,1-4H3 |
| InChIKey | VERJUBRUJKLOBF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|