C22H22N2O4S4 — CID 2327200
8-ethoxy-4,4-dimethyl-N-(4-methylphenyl)sulfonyl-1-sulfanylidenedithiolo[3,4-c]quinoline-5-carboxamide (PubChem CID 2327200) has the molecular formula C22H22N2O4S4 and a molecular weight of 506.70 g/mol. Its IUPAC name is 8-ethoxy-4,4-dimethyl-N-(4-methylphenyl)sulfonyl-1-sulfanylidenedithiolo[3,4-c]quinoline-5-carboxamide.
| Compound Name | 8-ethoxy-4,4-dimethyl-N-(4-methylphenyl)sulfonyl-1-sulfanylidenedithiolo[3,4-c]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 2327200 |
| Molecular Formula | C22H22N2O4S4 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 8-ethoxy-4,4-dimethyl-N-(4-methylphenyl)sulfonyl-1-sulfanylidenedithiolo[3,4-c]quinoline-5-carboxamide |
| SMILES | CCOc1ccc2c(c1)-c1c(ssc1=S)C(C)(C)N2C(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H22N2O4S4/c1-5-28-14-8-11-17-16(12-14)18-19(30-31-20(18)29)22(3,4)24(17)21(25)23-32(26,27)15-9-6-13(2)7-10-15/h6-12H,5H2,1-4H3,(H,23,25) |
| InChIKey | OXWKCMJSIFVWQX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|