C21H19NO2S3 — CID 1116081
2-phenoxy-1-(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone (PubChem CID 1116081) has the molecular formula C21H19NO2S3 and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-phenoxy-1-(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone.
| Compound Name | 2-phenoxy-1-(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
|---|---|
| PubChem CID | 1116081 |
| Molecular Formula | C21H19NO2S3 |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-phenoxy-1-(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
| SMILES | Cc1ccc2c(c1)N(C(=O)COc1ccccc1)C(C)(C)c1ssc(=S)c1-2 |
| InChI | InChI=1S/C21H19NO2S3/c1-13-9-10-15-16(11-13)22(17(23)12-24-14-7-5-4-6-8-14)21(2,3)19-18(15)20(25)27-26-19/h4-11H,12H2,1-3H3 |
| InChIKey | NOVWGWCYGHITBG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|