C30H28N2O11S3 — CID 90943137
tetramethyl 6'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 90943137) has the molecular formula C30H28N2O11S3 and a molecular weight of 688.76 g/mol. Its IUPAC name is tetramethyl 6'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetramethyl 6'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 90943137 |
| Molecular Formula | C30H28N2O11S3 |
| Molecular Weight | 688.76 g/mol |
| Exact Mass | 688.09 |
| IUPAC Name | tetramethyl 6'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(C(=O)OC)=C(C(=O)OC)SC1=C2c2ccccc2N(C(=O)Cn2c(O)ccc2O)C1(C)C |
| InChI | InChI=1S/C30H28N2O11S3/c1-29(2)24-19(14-9-7-8-10-15(14)32(29)18(35)13-31-16(33)11-12-17(31)34)30(20(25(36)40-3)21(44-24)26(37)41-4)45-22(27(38)42-5)23(46-30)28(39)43-6/h7-12,33-34H,13H2,1-6H3 |
| InChIKey | YODRVHNWZVAFCE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.76 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|