C30H29N3O12S3 — CID 91613270
tetramethyl 5'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-4'-methoxy-6',6'-dimethylspiro[1,3-dithiole-2,10'-thiopyrano[2,3-c][1,5]naphthyridine]-4,5,8',9'-tetracarboxylate (PubChem CID 91613270) has the molecular formula C30H29N3O12S3 and a molecular weight of 719.77 g/mol. Its IUPAC name is tetramethyl 5'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-4'-methoxy-6',6'-dimethylspiro[1,3-dithiole-2,10'-thiopyrano[2,3-c][1,5]naphthyridine]-4,5,8',9'-tetracarboxylate.
| Compound Name | tetramethyl 5'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-4'-methoxy-6',6'-dimethylspiro[1,3-dithiole-2,10'-thiopyrano[2,3-c][1,5]naphthyridine]-4,5,8',9'-tetracarboxylate |
|---|---|
| PubChem CID | 91613270 |
| Molecular Formula | C30H29N3O12S3 |
| Molecular Weight | 719.77 g/mol |
| Exact Mass | 719.09 |
| IUPAC Name | tetramethyl 5'-[2-(2,5-dihydroxypyrrol-1-yl)acetyl]-4'-methoxy-6',6'-dimethylspiro[1,3-dithiole-2,10'-thiopyrano[2,3-c][1,5]naphthyridine]-4,5,8',9'-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(C(=O)OC)=C(C(=O)OC)SC1=C2c2nccc(OC)c2N(C(=O)Cn2c(O)ccc2O)C1(C)C |
| InChI | InChI=1S/C30H29N3O12S3/c1-29(2)24-17(19-20(13(41-3)10-11-31-19)33(29)16(36)12-32-14(34)8-9-15(32)35)30(18(25(37)42-4)21(46-24)26(38)43-5)47-22(27(39)44-6)23(48-30)28(40)45-7/h8-11,34-35H,12H2,1-7H3 |
| InChIKey | VYZHFRSTDCGIJV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 193.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|