C30H33NO10S3 — CID 3534522
tetramethyl 7'-methoxy-5',5'-dimethyl-6'-(3-methylbutanoyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 3534522) has the molecular formula C30H33NO10S3 and a molecular weight of 663.79 g/mol. Its IUPAC name is tetramethyl 7'-methoxy-5',5'-dimethyl-6'-(3-methylbutanoyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetramethyl 7'-methoxy-5',5'-dimethyl-6'-(3-methylbutanoyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 3534522 |
| Molecular Formula | C30H33NO10S3 |
| Molecular Weight | 663.79 g/mol |
| Exact Mass | 663.13 |
| IUPAC Name | tetramethyl 7'-methoxy-5',5'-dimethyl-6'-(3-methylbutanoyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(C(=O)OC)=C(C(=O)OC)SC1=C2c2cccc(OC)c2N(C(=O)CC(C)C)C1(C)C |
| InChI | InChI=1S/C30H33NO10S3/c1-14(2)13-17(32)31-20-15(11-10-12-16(20)37-5)18-24(29(31,3)4)42-21(26(34)39-7)19(25(33)38-6)30(18)43-22(27(35)40-8)23(44-30)28(36)41-9/h10-12,14H,13H2,1-9H3 |
| InChIKey | LMFIQDCVQZNPJH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|