C33H30FNO11S3 — CID 124599525
tetramethyl 6'-[2-(4-fluorophenoxy)acetyl]-8'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 124599525) has the molecular formula C33H30FNO11S3 and a molecular weight of 731.80 g/mol. Its IUPAC name is tetramethyl 6'-[2-(4-fluorophenoxy)acetyl]-8'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetramethyl 6'-[2-(4-fluorophenoxy)acetyl]-8'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 124599525 |
| Molecular Formula | C33H30FNO11S3 |
| Molecular Weight | 731.80 g/mol |
| Exact Mass | 731.10 |
| IUPAC Name | tetramethyl 6'-[2-(4-fluorophenoxy)acetyl]-8'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(C(=O)OC)=C(C(=O)OC)SC1=C2c2ccc(OC)cc2N(C(=O)COc2ccc(F)cc2)C1(C)C |
| InChI | InChI=1S/C33H30FNO11S3/c1-32(2)27-22(19-13-12-18(41-3)14-20(19)35(32)21(36)15-46-17-10-8-16(34)9-11-17)33(23(28(37)42-4)24(47-27)29(38)43-5)48-25(30(39)44-6)26(49-33)31(40)45-7/h8-14H,15H2,1-7H3 |
| InChIKey | RUCSTNYGWRMEIS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|