About CID 11158724
CID 11158724 (PubChem CID 11158724) has the molecular formula C32H29NO16S5
and a molecular weight of 843.91 g/mol.
Molecular Properties
| Compound Name | CID 11158724 |
| PubChem CID | 11158724 |
| Molecular Formula | C32H29NO16S5 |
| Molecular Weight | 843.91 g/mol |
| Exact Mass | 843.01 |
| IUPAC Name | — |
| SMILES | CCn1c2c(c3c1C1(SC(C(=O)OC)=C(C(=O)OC)S1)C(C(=O)OC)=C3C(=O)OC)SC(C(=O)OC)=C(C(=O)OC)C21SC(C(=O)OC)=C(C(=O)OC)S1 |
| InChI | InChI=1S/C32H29NO16S5/c1-10-33-21-12(11(23(34)42-2)13(24(35)43-3)31(21)51-17(27(38)46-6)18(52-31)28(39)47-7)15-22(33)32(14(25(36)44-4)16(50-15)26(37)45-5)53-19(29(40)48-8)20(54-32)30(41)49-9/h10H2,1-9H3 |
| InChIKey | VZGPBQIPQZJMDB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 215.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 843.91 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze CID 11158724 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11158724?
The IUPAC name of CID 11158724 (CID 11158724) is not available.
What is the SMILES notation for CID 11158724?
The canonical SMILES for CID 11158724 is CCn1c2c(c3c1C1(SC(C(=O)OC)=C(C(=O)OC)S1)C(C(=O)OC)=C3C(=O)OC)SC(C(=O)OC)=C(C(=O)OC)C21SC(C(=O)OC)=C(C(=O)OC)S1.
What is the InChIKey of CID 11158724?
The InChIKey is VZGPBQIPQZJMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H29NO16S5/c1-10-33-21-12(11(23(34)42-2)13(24(35)43-3)31(21)51-17(27(38)46-6)18(52-31)28(39)47-7)15-22(33)32(14(25(36)44-4)16(50-15)26(37)45-5)53-19(29(40)48-8)20(54-32)30(41)49-9/h10H2,1-9H3.
What are the key properties of CID 11158724?
CID 11158724 has a molecular weight of 843.91 g/mol, XLogP of 2.71, 9 rotatable bonds, 0 hydrogen bond donors, and 22 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11158724 is sourced from PubChem (CID 11158724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).