C24H25NO9S5 — CID 11114859
tetraethyl 7'-ethyl-5'-oxospiro[1,3-dithiole-2,9'-3,4,12-trithia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),10-triene]-4,5,10',11'-tetracarboxylate (PubChem CID 11114859) has the molecular formula C24H25NO9S5 and a molecular weight of 631.80 g/mol. Its IUPAC name is tetraethyl 7'-ethyl-5'-oxospiro[1,3-dithiole-2,9'-3,4,12-trithia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),10-triene]-4,5,10',11'-tetracarboxylate.
| Compound Name | tetraethyl 7'-ethyl-5'-oxospiro[1,3-dithiole-2,9'-3,4,12-trithia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),10-triene]-4,5,10',11'-tetracarboxylate |
|---|---|
| PubChem CID | 11114859 |
| Molecular Formula | C24H25NO9S5 |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.01 |
| IUPAC Name | tetraethyl 7'-ethyl-5'-oxospiro[1,3-dithiole-2,9'-3,4,12-trithia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),10-triene]-4,5,10',11'-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)SC2(S1)C(C(=O)OCC)=C(C(=O)OCC)Sc1c2n(CC)c2c(=O)ssc12 |
| InChI | InChI=1S/C24H25NO9S5/c1-6-25-12-14(38-39-23(12)30)15-18(25)24(11(19(26)31-7-2)13(35-15)20(27)32-8-3)36-16(21(28)33-9-4)17(37-24)22(29)34-10-5/h6-10H2,1-5H3 |
| InChIKey | MHWTZZRLRNBVRU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 127.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|