C7H7NO3 — CID 45090151
methyl 4-cyano-2,5-dihydrofuran-3-carboxylate (PubChem CID 45090151) has the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. Its IUPAC name is methyl 4-cyano-2,5-dihydrofuran-3-carboxylate.
| Compound Name | methyl 4-cyano-2,5-dihydrofuran-3-carboxylate |
|---|---|
| PubChem CID | 45090151 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | methyl 4-cyano-2,5-dihydrofuran-3-carboxylate |
| SMILES | COC(=O)C1=C(C#N)COC1 |
| InChI | InChI=1S/C7H7NO3/c1-10-7(9)6-4-11-3-5(6)2-8/h3-4H2,1H3 |
| InChIKey | OIRPAPQLLAVIEB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |