methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate

C10H10N2O2 — CID 71502242

IUPACmethyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate
SMILESCOC(=O)C1=C(C#N)CCC1CC#N
InChIInChI=1S/C10H10N2O2/c1-14-10(13)9-7(4-5-11)2-3-8(9)6-12/h7H,2-4H2,1H3
InChIKeyJDNVBHIUSKDJIP-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.30
Rot. Bonds2

About methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate

methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate (PubChem CID 71502242) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate
PubChem CID71502242
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Namemethyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate
SMILESCOC(=O)C1=C(C#N)CCC1CC#N
InChIInChI=1S/C10H10N2O2/c1-14-10(13)9-7(4-5-11)2-3-8(9)6-12/h7H,2-4H2,1H3
InChIKeyJDNVBHIUSKDJIP-UHFFFAOYSA-N
XLogP1.30
TPSA73.88 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate?
The IUPAC name of methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate (CID 71502242) is methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate.
What is the SMILES notation for methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate?
The canonical SMILES for methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate is COC(=O)C1=C(C#N)CCC1CC#N.
What is the InChIKey of methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate?
The InChIKey is JDNVBHIUSKDJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-14-10(13)9-7(4-5-11)2-3-8(9)6-12/h7H,2-4H2,1H3.
What are the key properties of methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate?
methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate has a molecular weight of 190.20 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-5-(cyanomethyl)cyclopentene-1-carboxylate is sourced from PubChem (CID 71502242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).