About methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate
methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate (PubChem CID 170707878) has the molecular formula C9H8FNO2
and a molecular weight of 181.17 g/mol. Its IUPAC name is methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate.
Analyze methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate (CID 170707878) is methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=C(C#N)CC(F)C=C1.
What is the InChIKey of methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate?
The InChIKey is PXNJWKWXIRZULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2/c1-13-9(12)8-3-2-7(10)4-6(8)5-11/h2-3,7H,4H2,1H3.
What are the key properties of methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate?
methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate has a molecular weight of 181.17 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-4-fluorocyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 170707878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).