C15H11NO2 — CID 23243874
methyl 10-cyanotricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene-9-carboxylate (PubChem CID 23243874) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is methyl 10-cyanotricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene-9-carboxylate.
| Compound Name | methyl 10-cyanotricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene-9-carboxylate |
|---|---|
| PubChem CID | 23243874 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | methyl 10-cyanotricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene-9-carboxylate |
| SMILES | COC(=O)C1=C(C#N)C2C=CC1c1ccccc12 |
| InChI | InChI=1S/C15H11NO2/c1-18-15(17)14-12-7-6-11(13(14)8-16)9-4-2-3-5-10(9)12/h2-7,11-12H,1H3 |
| InChIKey | DFORENKKTVUSAN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|