C11H12O4 — CID 102305685
1-O-methyl 2-O-prop-2-ynyl 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 102305685) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-O-methyl 2-O-prop-2-ynyl 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | 1-O-methyl 2-O-prop-2-ynyl 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102305685 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-O-methyl 2-O-prop-2-ynyl 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | C#CCOC(=O)C1=C(C(=O)OC)C1(C)C |
| InChI | InChI=1S/C11H12O4/c1-5-6-15-10(13)8-7(9(12)14-4)11(8,2)3/h1H,6H2,2-4H3 |
| InChIKey | QKHJKWODIIMEME-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|