C15H24O4 — CID 15189596
ditert-butyl 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 15189596) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is ditert-butyl 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | ditert-butyl 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15189596 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | ditert-butyl 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C15H24O4/c1-13(2,3)18-11(16)9-10(15(9,7)8)12(17)19-14(4,5)6/h1-8H3 |
| InChIKey | HRYOUQJZILJQDD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |