C13H20O6 — CID 10956648
bis(2-methoxyethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 10956648) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is bis(2-methoxyethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | bis(2-methoxyethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10956648 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | bis(2-methoxyethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C(=O)OCCOC)C1(C)C |
| InChI | InChI=1S/C13H20O6/c1-13(2)9(11(14)18-7-5-16-3)10(13)12(15)19-8-6-17-4/h5-8H2,1-4H3 |
| InChIKey | KFTOPNZBNQZNGG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|