C13H16O8 — CID 11044776
bis(2-methoxy-2-oxoethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate (PubChem CID 11044776) has the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. Its IUPAC name is bis(2-methoxy-2-oxoethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate.
| Compound Name | bis(2-methoxy-2-oxoethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11044776 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | bis(2-methoxy-2-oxoethyl) 3,3-dimethylcyclopropene-1,2-dicarboxylate |
| SMILES | COC(=O)COC(=O)C1=C(C(=O)OCC(=O)OC)C1(C)C |
| InChI | InChI=1S/C13H16O8/c1-13(2)9(11(16)20-5-7(14)18-3)10(13)12(17)21-6-8(15)19-4/h5-6H2,1-4H3 |
| InChIKey | MADIQRRFDUUAJD-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|